| Identification | |
| Name: | 2-Aminoacetic acid hydrochloride |
| Synonyms: | Glycine,hydrochloride (8CI,9CI);Aminoacetic acid hydrochloride;Glycocollhydrochloride; |
| CAS: | 6000-43-7 |
| EINECS: | 227-841-8 |
| Molecular Formula: | C2H5NO2?HCl |
| Molecular Weight: | 111.52 |
| InChI: | InChI=1/C2H5NO2.ClH/c3-1-2(4)5;/h1,3H2,(H,4,5);1H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1789 |
| Density: | 1.27g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.644 |
| Water Solubility: | SLIGHTLY SOLUBLE |
| Solubility: | Slightly soluble |
| Appearance: | White crystalline powder |
| Specification: |
The chemical synonyms of 2-Aminoacetic acid hydrochloride (CAS NO.6000-43-7) are Aminoethanoic acid hydrochloride ; Aminoacetic acid hydrochloride ; Glycocoll hydrochloride ; Glycine hcl ; Glycine-hcl buffer ; Glycine hydrochloride ; Glycine hydrochloride solution ; Aminoaceticacid.hcl=h-gly-oh.hcl . It shoud avoid breathing dust, vapor, mist, or gas and should be stored in a cool, dry place. Ingestion of large amounts may cause gastrointestinal irritation. Low hazard for usual industrial handling. It can be used to improve the bitter taste of beer, but also can be used in behalf of salts, nutritional supplements, flavor enhancer. |
| Report: |
Reported in EPA TSCA Inventory. |
| Storage Temperature: | 2-8°C |
| Sensitive: | Hygroscopic |
| Color: | White crystals MONOCLINIC OR TRIGONAL PRISMS FROM DILUTE ALCOHOL Monoclinic prisms from alc |
| Usage: | Non essential amino acid. |
| Safety Data | |
 |
|
