| Identification | |
| Name: | 2-(m-Bromophenyl)-N-(4-morpholinomethyl)succinimide |
| Synonyms: | BRN 0928013;N-Morpholinomethyl-3-bromophenylsuccinimide;2-(m-Bromophenyl)-N-(4-morpholinomethyl)succinimide;Succinimide, 2-(m-bromophenyl)-N-(4-morpholinomethyl)-;AC1MIDMN;IL-7;LS-147546;2,5-Pyrrolidinedione, 3-(3-bromophenyl)-1-(4-morpholinomethyl)-;3-(3-bromophenyl)-1-(morpholin-4-ylmethyl)pyrrolidine-2,5-dione;2,5-Pyrrolidinedione, 3-(3-bromophenyl)-1-(4-morpholinomethyl)- (9CI);60050-37-5 |
| CAS: | 60050-37-5 |
| Molecular Formula: | C15H17BrN2O3 |
| Molecular Weight: | 353.2111 |
| InChI: | InChI=1/C15H17BrN2O3/c16-12-3-1-2-11(8-12)13-9-14(19)18(15(13)20)10-17-4-6-21-7-5-17/h1-3,8,13H,4-7,9-10H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 264.9°C |
| Boiling Point: | 514.3°C at 760 mmHg |
| Density: | 1.5g/cm3 |
| Refractive index: | 1.601 |
| Specification: |
2-(m-Bromophenyl)-N-(4-morpholinomethyl)succinimide (CAS NO.60050-37-5) is a kind of organic matter,Its toxicity is not large, but there are many aspects still need to be paid attention. |
| Report: |
2-(m-Bromophenyl)-N-(4-morpholinomethyl)succinimide (CAS NO.60050-37-5) is Reported by VEB Verlag Volk und Gesundheit,Neue Gruenstr. 18,Berlin DDR-1020, Ger. Dem.Rep. |
| Flash Point: | 264.9°C |
| Safety Data | |
 |
|
