| Identification | |
| Name: | Ethyl p-iodophenyethyl carbonate |
| Synonyms: | Carbonic acid ethyl p-iodophenethyl ester |
| CAS: | 60075-76-5 |
| Molecular Formula: | C11H13IO3 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C11H13IO3/c1-2-14-11(13)15-8-7-9-3-5-10(12)6-4-9/h3-6H,2,7-8H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 153.8°C |
| Boiling Point: | 330.6°C at 760 mmHg |
| Density: | 1.571g/cm3 |
| Refractive index: | 1.562 |
| Specification: |
Ethyl p-iodophenyethyl carbonate , its cas register number is 60075-76-5. It also can be called BRN 2458426 ; Carbonic acid, ethyl p-iodophenethyl ester . When Ethyl p-iodophenyethyl carbonate (CAS NO.60075-76-5) is heated to decomposition it emits toxic vapors of I−. |
| Flash Point: | 153.8°C |
| Safety Data | |
 |
|
