| Identification | |
| Name: | Carbonic acid 3-(p-iodophenyl)-3-methylpropyl isopropyl ester |
| Synonyms: | Isopropyl[3-(p-iodophenyl)butyl] =carbonate |
| CAS: | 60075-83-4 |
| Molecular Formula: | C14H19IO3 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C14H19IO3/c1-10(2)18-14(16)17-9-8-11(3)12-4-6-13(15)7-5-12/h4-7,10-11H,8-9H2,1-3H3 |
| Molecular Structure: | ![(C14H19IO3) Isopropyl[3-(p-iodophenyl)butyl] =carbonate](https://img.guidechem.com/crawlimg/60075-83-4.png) |
| Properties | |
| Flash Point: | 176.2°C |
| Boiling Point: | 367.7°C at 760 mmHg |
| Density: | 1.424g/cm3 |
| Refractive index: | 1.541 |
| Specification: |
Carbonic acid 3-(p-iodophenyl)-3-methylpropyl isopropyl ester , its cas register number is 60075-83-4. It also can be called Carbonic acid, isopropyl ester, ester with 3-(p-iodophenyl)butanol . |
| Flash Point: | 176.2°C |
| Safety Data | |
 |
|
