Identification |
Name: | 1-Nonanone, 1-phenyl- |
Synonyms: | Nonanophenone(6CI,7CI,8CI); Pelargonophenone (4CI); 1-Phenyl-1-nonanone; Nonanoylbenzene;Octyl phenyl ketone; Pelargonylbenzene; n-Octyl phenyl ketone |
CAS: | 6008-36-2 |
EINECS: | 227-861-7 |
Molecular Formula: | C15H22O |
Molecular Weight: | 218.338 |
InChI: | InChI=1/C15H22O/c1-2-3-4-5-6-10-13-15(16)14-11-8-7-9-12-14/h7-9,11-12H,2-6,10,13H2,1H3 |
Molecular Structure: |
 |
Properties |
Melting Point: | 14°C |
Boiling Point: | 139-140°C 2mm |
Density: | 0,94 g/cm3 |
Refractive index: | 1.5005-1.5025 |
Specification: | CLEAR COLOURLESS TO LIGHT YELLOW LIQUID Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
Safety Data |
|
 |