| Identification | |
| Name: | 9-Phenylanthracene |
| Synonyms: | 9-Phenylanthracene,98%;9-Phenylanthracene 97%;9-Phenylanthracene oekanal, 250 mg;Phenylanthracene,98%; |
| CAS: | 602-55-1 |
| EINECS: | 210-019-8 |
| Molecular Formula: | C20H14 |
| Molecular Weight: | 254.33 |
| InChI: | InChI=1/C20H14/c1-2-8-15(9-3-1)20-18-12-6-4-10-16(18)14-17-11-5-7-13-19(17)20/h1-14H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3077 9/PG 3 |
| Density: | 1.14 g/cm3 |
| Refractive index: | 1.703 |
| Appearance: | Pale Yellow Plates |
| Specification: |
9-Phenylanthracene , with CAS number of 602-55-1, can be called anthracene,9-phenyl- ; Phenylanthracene,98% ; 9-Phenylanthracene oekanal, 250 mg ; 9-Phenylanthracene 97% ; 9-Phenylanthracene,98% . It is a pale yellow plate. |
| Safety Data | |
| Hazard Symbols |
N: Dangerous for the environment
|
 |
|
