| Identification | |
| Name: | 2,4,6-trinitro-m-cresol |
| Synonyms: | 2,4,6-Trinitro-3-methylphenol;AI3-15427;Cresylite;NSC 3182;Picric acid, 3-methyl-;Picric acid, methyl-;Trinitro-m-cresol;Trinitro-m-cresolic acid;Phenol,3-methyl-2,4,6-trinitro-;M-Cresol,2,4,6-trinitro-(8CI) |
| CAS: | 602-99-3 |
| EINECS: | 210-027-1 |
| Molecular Formula: | C7H5N3O7 |
| Molecular Weight: | 243.1305 |
| InChI: | InChI=1/C7H5N3O7/c1-3-4(8(12)13)2-5(9(14)15)7(11)6(3)10(16)17/h2,11H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 139.1°C |
| Boiling Point: | 320.9°C at 760 mmHg |
| Density: | 1.74g/cm3 |
| Refractive index: | 1.676 |
| Specification: |
2,4,6-Trinitro-m-cresol ,its cas register number is 602-99-3. It also can be called 2,4,6-Trinitro-3-methylphenol ; 3-Methyl-2,4,6-trinitro-phenol ; and Picric acid, 3-methyl- . 2,4,6-Trinitro-m-cresol (CAS NO.602-99-3) is sensitive to heat, and is a nitroaryl derivative. Nitroaryls range from slight to strong oxidizing agents. If mixed with reducing agents, including hydrides, sulfides and nitrides, they may begin a vigorous reaction that culminates in a detonation. Under prolonged exposure to fire or heat the containers may explode violently. |
| Flash Point: | 139.1°C |
| Safety Data | |
 |
|
