| Identification | |
| Name: | N-Fluoren-2-ylacetohydroxamic acid, potassium salt |
| Synonyms: | N-(9H-Fluoren-2-yl)acetohydroxamic acid potassium salt |
| CAS: | 6023-26-3 |
| Molecular Formula: | C15H13NO2 . K |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C15H12NO2.K/c1-10(17)16(18)13-6-7-15-12(9-13)8-11-4-2-3-5-14(11)15;/h2-7,9H,8H2,1H3;/q-1;+1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 229°C |
| Boiling Point: | 455.1°C at 760 mmHg |
| Density: | g/cm3 |
| Specification: |
N-Fluoren-2-ylacetohydroxamic acid, potassium salt , its cas register number is 6023-26-3. It also can be called Acetohydroxamic acid, N-fluoren-2-yl-, potassium salt ; Potassium N-fluoren-2-ylacetohydroxamate ; and N-Hydroxy-2-acetylaminofluorene, potassium salt . |
| Flash Point: | 229°C |
| Safety Data | |
 |
|
