| Identification | |
| Name: | 4(3H)-Quinazolinone,5-chloro- |
| Synonyms: | 4(1H)-Quinazolinone,5-chloro- (6CI,9CI);5-Chloro-4-quinazolinone;NSC 601362; |
| CAS: | 60233-66-1 |
| Molecular Formula: | C8H5ClN2O |
| Molecular Weight: | 180.59 |
| InChI: | InChI=1/C8H5ClN2O/c9-5-2-1-3-6-7(5)8(12)11-4-10-6/h1-4H,(H,10,11,12) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.5 g/cm3 |
| Refractive index: | 1.688 |
| Specification: |
The CAS register number of 5-Chloro-3H-quinazolin-4-one is 60233-66-1. It also can be called as 4(3H)-Quinazolinone,5-chloro- and the systematic name about this chemical is 5-chloroquinazolin-4(1H)-one. The molecular formula about this chemical is C8H5ClN2O and the molecular weight is 180.59. It belongs to the following product categories, such as Blocks; Heterocycles; Quinolines; Alcohols and Derivatives and so on. Physical properties about 5-Chloro-3H-quinazolin-4-one are: (1)ACD/LogP: 1.37; (2)ACD/LogD (pH 5.5): 1.37; (3)ACD/LogD (pH 7.4): 1.37; (4)ACD/BCF (pH 5.5): 6.42; (5)ACD/BCF (pH 7.4): 6.42; (6)ACD/KOC (pH 5.5): 131.7; (7)ACD/KOC (pH 7.4): 131.7; (8)#H bond acceptors: 3; (9)#H bond donors: 1; (10)Polar Surface Area: 32.67Å2; (11)Index of Refraction: 1.688; (12)Molar Refractivity: 45.87 cm3; (13)Molar Volume: 120.2 cm3; (14)Polarizability: 18.18x10-24cm3; (15)Surface Tension: 55.1 dyne/cm; (16)Enthalpy of Vaporization: 59.86 kJ/mol; (17)Boiling Point: 353.6 °C at 760 mmHg; (18)Vapour Pressure: 3.54E-05 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
