Identification |
Name: | 1-(2-Aminophenyl)pyrrole |
Synonyms: | 2-(1-Pyrrolyl)aniline; 2-(1H-Pyrrol-1-yl)aniline |
CAS: | 6025-60-1 |
EINECS: | 227-884-2 |
Molecular Formula: | C10H10N2 |
Molecular Weight: | 158.20 |
InChI: | InChI=1/C10H10N2/c11-9-5-1-2-6-10(9)12-7-3-4-8-12/h1-8H,11H2 |
Molecular Structure: |
 |
Properties |
Flash Point: | 136.4°C |
Boiling Point: | 301.9°C at 760 mmHg |
Density: | 1.09g/cm3 |
Refractive index: | 1.602 |
Appearance: | light beige to brown crystal, powder and needles |
Packinggroup: | III |
Flash Point: | 136.4°C |
Safety Data |
|
 |