| Identification | |
| Name: | 3-Nitrophthalimide |
| Synonyms: | Phthalimide,3-nitro- (6CI,7CI,8CI); |
| CAS: | 603-62-3 |
| EINECS: | 210-051-2 |
| Molecular Formula: | C8H4N2O4 |
| Molecular Weight: | 192.12836 |
| InChI: | InChI=1S/C8H4N2O4/c11-7-4-2-1-3-5(10(13)14)6(4)8(12)9-7/h1-3H,(H,9,11,12) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.609 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.657 |
| Water Solubility: | Soluble In Alakaline Medium & Organic Solvent. |
| Solubility: | Soluble In Alakaline Medium & Organic Solvent. |
| Appearance: | yellow to straw-yellow crystalline powder |
| Specification: |
3-Nitrophthalimide (CAS NO.603-62-3) is also named as AI3-08841 ; NSC 5393 ; Phthalimide, 3-nitro- ; 1H-Isoindole-1,3(2H)-dione, 4-nitro- . 3-Nitrophthalimide (CAS NO.603-62-3) is yellow to straw-yellow crystalline powder. |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
