| Identification |
| Name: | Benzoicacid, 2,3-dimethyl- |
| Synonyms: | 2,3-Dimethylbenzoicacid;Hemellitic acid;NSC 407533; |
| CAS: | 603-79-2 |
| EINECS: | 210-058-0 |
| Molecular Formula: | C9H10O2 |
| Molecular Weight: | 150.18 |
| InChI: | InChI=1/C9H10O2/c1-6-4-3-5-8(7(6)2)9(10)11/h3-5H,1-2H3,(H,10,11) |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.116 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Solubility: | Very soluble |
| Appearance: | white to light yellow crystal powder |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
