| Identification | |
| Name: | Benzoic acid,3-hydroxy-2-methyl- |
| Synonyms: | NSC73133;2-Methyl-3-hydroxybenzoic acid;3,2-Cresoticacid (8CI); |
| CAS: | 603-80-5 |
| EINECS: | -0 |
| Molecular Formula: | C8H8O3 |
| Molecular Weight: | 152.15 |
| InChI: | InChI=1/C8H8O3/c1-5-6(8(10)11)3-2-4-7(5)9/h2-4,9H,1H3,(H,10,11)/p-1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 171.6 ºC |
| Boiling Point: | 336.6 ºC at 760 mmHg |
| Density: | 1.304 g/cm3 |
| Refractive index: | 1.599? |
| Appearance: | white crystal |
| Specification: | Light Yellow Crystalline Solid Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 171.6 ºC |
| Safety Data | |
 |
|
