| Identification | |
| Name: | Benzene,1,2,4-tribromo-5-(2,4-dibromophenoxy)- |
| Synonyms: | 2,2',4,4',5-Pentabromodiphenylether; 2,2',4,4',5-Pentabromodiphenyl oxide; BDE 99; PBDE 99; Tardex 50; Tardex50L |
| CAS: | 60348-60-9 |
| Molecular Formula: | C12H5 Br5 O |
| Molecular Weight: | 564.6875 |
| InChI: | InChI=1S/C12H5Br5O/c13-6-1-2-11(9(16)3-6)18-12-5-8(15)7(14)4-10(12)17/h1-5H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1262 3/PG 2 |
| Melting Point: | -7 to -3 deg C (commercial) |
| Flash Point: | -12 °C |
| Boiling Point: | Decomposes at 200-300 deg C (commercial) |
| Solubility: | Methanol, 1g/100g; dioctylphthalate, >100g/100g; completely miscible in methylene chloride, toluene, freon 11, polyol, styrene, and methyl ethyl ketone In water, 0.0133 mg/l (commercial product). |
| Flash Point: | -12 °C |
| Storage Temperature: | 2-8°C |
| Color: | White crystalline solid |
| Safety Data | |
| Hazard Symbols | |
 |
|
