Identification |
Name: | b-D-Glucopyranose, 1,2,3,4,6-pentaacetate |
Synonyms: | Pentaacetyl-b-D-glucopyranose;Pentaacetyl-b-D-glucose;Per-O-acetyl-b-D-glucopyranose;b-D-Glucopyranosyl pentaacetate;b-D-Glucose pentaacetate;Glucopyranose,pentaacetate, b-D- (8CI);b-D-Glucopyranose, pentaacetate (9CI);1,2,3,4,6-Penta-O-acetyl-b-D-glucopyranose;2,3,4,6-Tetra-O-acetyl-b-D-glucopyranosyl acetate;NSC 214078;Penta-O-acetyl-b-D-glucopyranose;Penta-O-acetyl-b-D-glucose; |
CAS: | 604-69-3 |
EINECS: | 210-074-8 |
Molecular Formula: | C16H22O11 |
Molecular Weight: | 390.33928 |
InChI: | InChI=1S/C16H22O11/c1-7(17)22-6-12-13(23-8(2)18)14(24-9(3)19)15(25-10(4)20)16(27-12)26-11(5)21/h12-16H,6H2,1-5H3 |
Molecular Structure: |
|
Properties |
Density: | 1.3 g/cm3 |
Stability: | Stable under normal temperatures and pressures. |
Alpha: | 5 o (C=1, CHCL3) |
Water Solubility: | 0.1 g/mL, clear, colorless |
Solubility: | 0.1 g/mL, clear, colorless |
Appearance: | white to beige powder |
HS Code: | 29400090 |
Safety Data |
Hazard Symbols |
Xn: Harmful
Xi: Irritant
|
|
|