| Identification | |
| Name: | 2-Naphthalenamine,6-chloro-1,2,3,4-tetrahydro- |
| Synonyms: | 6-Chloro-1,2,3,4-tetrahydro-b-naphthylamine;6-Chloro-2-aminotetralin; |
| CAS: | 60480-00-4 |
| Molecular Formula: | C10H12ClN |
| Molecular Weight: | 181.66 |
| InChI: | InChI=1/C10H12ClN/c11-9-3-1-8-6-10(12)4-2-7(8)5-9/h1,3,5,10H,2,4,6,12H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.166 g/cm3 |
| Refractive index: | 1.575 |
| Specification: |
The CAS register number of 6-Chloro-1,2,3,4-tetrahydronaphthalen-2-amine is 60480-00-4. It also can be called as 2-Naphthalenamine,6-chloro-1,2,3,4-tetrahydro- and the systematic name about this chemical is 6-chloro-1,2,3,4-tetrahydronaphthalen-2-amine. The molecular formula about this chemical is C10H12ClN and the molecular weight is 181.66. Physical properties about 6-Chloro-1,2,3,4-tetrahydronaphthalen-2-amine are: (1)ACD/LogP: 2.70; (2)ACD/BCF (pH 5.5): 1; (3)ACD/BCF (pH 7.4): 1; (4)ACD/KOC (pH 5.5): 1; (5)ACD/KOC (pH 7.4): 3; (6)#H bond acceptors: 1; (7)#H bond donors: 2; (8)#Freely Rotating Bonds: 1; (9)Polar Surface Area: 26.02Å2; (10)Index of Refraction: 1.575; (11)Molar Refractivity: 51.487 cm3; (12)Molar Volume: 155.785 cm3; (13)Polarizability: 20.411x10-24cm3; (14)Surface Tension: 43.145 dyne/cm; (15)Enthalpy of Vaporization: 52.314 kJ/mol; (16)Boiling Point: 284.169 °C at 760 mmHg; (17)Vapour Pressure: 0.003 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
