| Identification | |
| Name: | 1,4-Naphthalenedicarboxylicacid |
| Synonyms: | 1,4-Dicarboxynaphthalene; |
| CAS: | 605-70-9 |
| EINECS: | 210-094-7 |
| Molecular Formula: | C12H8O4 |
| Molecular Weight: | 216.19 |
| InChI: | InChI=1/C12H8O4/c13-11(14)9-5-6-10(12(15)16)8-4-2-1-3-7(8)9/h1-6H,(H,13,14)(H,15,16) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.454 g/cm3 |
| Refractive index: | 1.708 |
| Appearance: | Light yellow power |
| Specification: |
1,4-Naphthalenedicarboxylicacid , its cas register number is 605-70-9. It also can be called Naphthalene-1,4-dicarboxylic acid ; 1,4-Naphthalic acid . 1,4-Naphthalenedicarboxylicacid (CAS NO.605-70-9) is irritating to eyes, respiratory system and skin. In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
