| Identification | |
| Name: | 1H-Naphtho[2,1-b]pyran-1-one,3-phenyl- |
| Synonyms: | 5,6-Benzoflavone(6CI,7CI); 3-Phenyl-1H-naphtho[2,1-b]pyran-1-one; BNF; NSC 136015; b-Naphthoflavone |
| CAS: | 6051-87-2 |
| EINECS: | 227-958-4 |
| Molecular Formula: | C19H12 O2 |
| Molecular Weight: | 272.30 |
| InChI: | InChI=1/C19H12O2/c20-16-12-18(14-7-2-1-3-8-14)21-17-11-10-13-6-4-5-9-15(13)19(16)17/h1-12H |
| Molecular Structure: | ![(C19H12O2) 5,6-Benzoflavone(6CI,7CI); 3-Phenyl-1H-naphtho[2,1-b]pyran-1-one; BNF; NSC 136015; b-Naphthoflavone](https://img.guidechem.com/casimg/6051-87-2.gif) |
| Properties | |
| Flash Point: | 215.8°C |
| Boiling Point: | 275-280 °C (1 mmHg) |
| Density: | 1.276g/cm3 |
| Refractive index: | 1.695 |
| Specification: |
beta-Naphthoflavone ,its cas register number is 6051-87-2. It also can be called BNF ; 3-Phenyl-1H-benzo[f]chromen-1-one ; b-Naphthoflavone and 1H-naphtho[2,1-b]pyran-1-one, 3-phenyl- . beta-Naphthoflavone (CAS NO.6051-87-2) is also known as 5,6-Benzoflavone . β-Naphthoflavone is a putative chemopreventive agent. It is a potent agonist of the aryl hydrocarbon receptor and as such is an inducer of such detoxification enzymes as cytochromes P450 (CYPs) and uridine 5'-diphospho-glucuronosyltransferases (UGTs). |
| Flash Point: | 215.8°C |
| Storage Temperature: | 2-8°C |
| Color: | yellow to tan |
| Safety Data | |
| Hazard Symbols | |
 |
|
