| Identification |
| Name: | N-(4-FLUOROPHENYL)PYRIDIN-2(1H)-ONE |
| Synonyms: | N-(4-FLUOROPHENYL)PYRIDIN-2(1H)-ONE |
| CAS: | 60532-42-5 |
| Molecular Formula: | C11H8FNO |
| Molecular Weight: | 189.1857232 |
| InChI: | InChI=1/C11H8FNO/c12-9-4-6-10(7-5-9)13-8-2-1-3-11(13)14/h1-8H |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 160.453°C |
| Boiling Point: | 341.697°C at 760 mmHg |
| Density: | 1.27g/cm3 |
| Refractive index: | 1.592 |
| Flash Point: | 160.453°C |
| Usage: | A metabolite of Pirfenidone, a new drug to treat patients with kidney disease who have diabetes |
| Safety Data |
| |
 |
