| Identification | |
| Name: | 2H-Benzimidazol-2-one,5,6-dichloro-1-ethyl-1,3-dihydro- |
| Synonyms: | 2-Benzimidazolinone,5,6-dichloro-1-ethyl- (6CI) |
| CAS: | 60563-36-2 |
| Molecular Formula: | C9H8 Cl2 N2 O |
| Molecular Weight: | 231.08 |
| InChI: | InChI=1/C9H8Cl2N2O/c1-2-13-8-4-6(11)5(10)3-7(8)12-9(13)14/h3-4H,2H2,1H3,(H,12,14) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.413g/cm3 |
| Refractive index: | 1.592 |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Biological Activity: | Stimulates Cl - secretion via activation of hIK1 K + channels and the activation of an apical Cl - conductance. More potent than its analog 1-EBIO (1-Ethyl-2-benzimidazolinone ). |
| Storage Temperature: | Store at RT |
| Color: | off-white |
| Safety Data | |
 |
|
