| Identification | |
| Name: | Bis(4-methylphenyl)iodonium hexafluorophosphate |
| Synonyms: | Bis(p-tolyl)iodonium hexafluorophosphate;BIS(4-METHYLPHENYL)IODONIUM;Iodonium bis(4-methylphenyl) Hexafluorophosphate; |
| CAS: | 60565-88-0 |
| EINECS: | 262-301-5 |
| Molecular Formula: | C14H14I.F6P |
| Molecular Weight: | 454.13 |
| InChI: | InChI=1/C14H14I.F6P/c1-11-3-7-13(8-4-11)15-14-9-5-12(2)6-10-14;1-7(2,3,4,5)6/h3-10H,1-2H3;/q+1;-1 |
| Molecular Structure: |  |
| Properties | |
| Appearance: | White powder |
| Specification: |
The Bis(4-methylphenyl)iodonium hexafluorophosphate with the cas number 60565-88-0 is also called Iodonium bis(4-methylphenyl) Hexafluorophosphate. The systematic name is Bis(p-tolyl)iodonium hexafluorophosphate. Its EINECS registry number is 262-301-5. The molecular formula is C14H14I.F6P. This chemical should be stored in dry and cool environment. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
