The Bis(4-methylphenyl)iodonium hexafluorophosphate with the cas number 60565-88-0 is also called Iodonium bis(4-methylphenyl) Hexafluorophosphate. The systematic name is Bis(p-tolyl)iodonium hexafluorophosphate. Its EINECS registry number is 262-301-5. The molecular formula is C14H14I.F6P. This chemical should be stored in dry and cool environment.
You can still convert the following datas into molecular structure:
(1)SMILES: F[P-](F)(F)(F)(F)F.Cc1ccc(cc1)[I+]c2ccc(C)cc2
(2)InChI: InChI=1/C14H14I.F6P/c1-11-3-7-13(8-4-11)15-14-9-5-12(2)6-10-14;1-7(2,3,4,5)6/h3-10H,1-2H3;/q+1;-1
(3)InChIKey: LHLVGWWCRPPKBC-UHFFFAOYAR
|