| Identification | |
| Name: | 1,3,4-Oxadiazol-2(3H)-one,5-methoxy-3-(2-methoxyphenyl)- |
| Synonyms: | 32861;5-Methoxy-3-(2-methoxyphenyl)-1,3,4-oxadiazolin-2-one; Elemic; Metoxadiazone;RP 32861; RPJ 168; S 21074 |
| CAS: | 60589-06-2 |
| Molecular Formula: | C10H10 N2 O4 |
| Molecular Weight: | 222.22 |
| InChI: | InChI=1S/C10H10N2O4/c1-14-8-6-4-3-5-7(8)12-10(13)16-9(11-12)15-2/h3-6H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Specification: |
Metoxadiazone with cas registry number of 60589-06-2 is a kind of insecticide. It is light yellow to russet crystal or crystalline powder, also known as 3-(2-Methoxyphenyl)-5-methoxy-1,3,4-oxadiazol-2(3H)-one ; Metoxadiazone [ISO] ; 2-Methoxy-4-(o-methoxyphenyl)-delta(sup 2)-1,3,4-oxadiazolin-5-one ; Methoxy-2(methoxy-2 phenyl)-4 oxadiazoline-1,3,4 one-5 ; 32861 R.P. ; delta(sup 2)-1,3,4-Oxadiazolin-5-one, 2-methoxy-4-(o-methoxyphenyl)- ; Methoxy-2(methoxy-2 phenyl)-4 oxadiazoline-1,3,4 one-5 [French] ; 1,3,4-Oxadiazol-2(3H)-one, 5-methoxy-3-(2-methoxyphenyl)- . |
| Safety Data | |
 |
|
