| Identification | |
| Name: | 2-Propanone,1,1'-(nitrosoimino)bis- |
| Synonyms: | BOP;Bis(2-oxopropyl)-N-nitrosamine; Bis(2-oxopropyl)nitrosamine;N-Nitrosobis(2-oxopropyl)amine; Nitrosobis(2-oxopropyl)amine |
| CAS: | 60599-38-4 |
| EINECS: | 260-279-1 |
| Molecular Formula: | C6H10 N2 O3 |
| Molecular Weight: | 158.18 |
| InChI: | InChI=1/C6H10N2O3/c1-5(9)3-8(7-11)4-6(2)10/h3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 136 °C |
| Flash Point: | 144.8°C |
| Boiling Point: | 315.8°C at 760 mmHg |
| Density: | 1.17g/cm3 |
| Refractive index: | 1.496 |
| Specification: | White Crystalline Solid usageEng:N-Nitrosobis(2-oxopropyl)amine is a potent and selective pancreatic carcinogen in the Syrian golden hamster. This model has been used to study pancreatic cancer as chemically induced pancreatic neoplasms are morphologically similar to those found in man. |
| Flash Point: | 144.8°C |
| Usage: | N-Nitrosobis(2-oxopropyl)amine is a potent and selective pancreatic carcinogen in the Syrian golden hamster. This model has been used to study pancreatic cancer as chemically induced pancreatic neoplasms are morphologically similar to those found i |
| Safety Data | |
 |
|
