| Identification | |
| Name: | 2,5-Cyclohexadiene-1,4-dione,2-[(2E)-3,7-dimethyl-2,6-octadien-1-yl]-5,6-dimethoxy-3-methyl- |
| Synonyms: | 2,5-Cyclohexadiene-1,4-dione,2-(3,7-dimethyl-2,6-octadienyl)-5,6-dimethoxy-3-methyl-, (E)-;2,5-Cyclohexadiene-1,4-dione,2-[(2E)-3,7-dimethyl-2,6-octadienyl]-5,6-dimethoxy-3-methyl- (9CI);p-Benzoquinone, 2-(3,7-dimethyl-2,6-octadienyl)-5,6-dimethoxy-3-methyl-, (E)-(8CI); p-Benzoquinone, 2-geranyl-5,6-dimethoxy-3-methyl- (6CI);2,3-Dimethoxy-5-geranyl-6-methyl-1,4-benzoquinone; Coenzyme Q2; Q 2; Ubiquinone10; Ubiquinone 2; Ubiquinone Q2 |
| CAS: | 606-06-4 |
| EINECS: | 206-147-9 |
| Molecular Formula: | C19H26 O4 |
| Molecular Weight: | 318.40734 |
| InChI: | InChI=1S/C19H26O4/c1-12(2)8-7-9-13(3)10-11-15-14(4)16(20)18(22-5)19(23-6)17(15)21/h8,10H,7,9,11H2,1-6H3/b13-10+ |
| Molecular Structure: |  |
| Properties | |
| Stability: | Stable, but light and heat sensitive. Store in the dark at -20 C. Incompatible with strong oxidizing agents. |
| Water Solubility: | Stability Stable, but light and heat sensitive. Store in the darkat -20 C. Incompatible with strong oxidizing agents. Toxicology Not hazardous according to Directive 67/548/EEC. |
| Solubility: |
|
| Appearance: | solid |
| Storage Temperature: | −20°C |
| Safety Data | |
 |
|
