| Identification |
| Name: | Benzoic acid,2-benzoyl-, methyl ester |
| Synonyms: | Benzoicacid, o-benzoyl-, methyl ester (6CI,7CI,8CI);Initiator 1056;Methyl o-benzoylbenzoate;NSC 3797;OBM 100;Speedcure MBB;o-(Methoxycarbonyl)benzophenone; |
| CAS: | 606-28-0 |
| EINECS: | 210-112-3 |
| Molecular Formula: | C15H12O3 |
| Molecular Weight: | 240.26 |
| InChI: | InChI=1/C15H12O3/c1-18-15(17)13-10-6-5-9-12(13)14(16)11-7-3-2-4-8-11/h2-10H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3077 9/PG 3 |
| Density: | 1.169 g/cm3 |
| Stability: | Stable at normal temperatures and pressures. |
| Solubility: | 0.14 g/L (25 C) |
| Appearance: | Solid. |
| Packinggroup: | III |
| Storage Temperature: | Keep containers tightly closed. |
| Safety Data |
| Hazard Symbols |
N: Dangerous for the environment
|
| |
 |
