Identification |
Name: | Naphthalene,1,3-dinitro- |
Synonyms: | 1,3-Dinitronaphthalene;NSC 74478 |
CAS: | 606-37-1 |
EINECS: | 210-116-5 |
Molecular Formula: | C10H6 N2 O4 |
Molecular Weight: | 218.18 |
InChI: | InChI=1/C10H6N2O4/c13-11(14)8-5-7-3-1-2-4-9(7)10(6-8)12(15)16/h1-6H |
Molecular Structure: |
 |
Properties |
Transport: | 2811 |
Melting Point: | 146-148 °C(lit.)
|
Flash Point: | 191.51°C |
Boiling Point: | 377.211°C at 760 mmHg |
Density: | 1.482g/cm3 |
Stability: | Stability Stable, but may be heat or shock sensitive. Incompatible with strong bases, strong oxidizing agents. |
Refractive index: | 1.704 |
Specification: | beige powder Safety Statements:26-37/39 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face
protection |
Packinggroup: | III |
Flash Point: | 191.51°C |
Safety Data |
|
 |