| Identification |
| Name: | Benzoic acid,2-methoxy-, methyl ester |
| Synonyms: | Benzoicacid, o-methoxy-, methyl ester (4CI);o-Anisic acid, methyl ester(6CI,7CI,8CI);2-Methoxybenzoic acid methyl ester;Methyl 2-methoxybenzoate;Methyl o-anisate;Methyl o-methoxybenzoate;NSC 406256;o-Methoxybenzoic acidmethyl ester; |
| CAS: | 606-45-1 |
| EINECS: | 210-118-6 |
| Molecular Formula: | C9H10O3 |
| Molecular Weight: | 166.1739 |
| InChI: | InChI=1S/C9H10O3/c1-11-8-6-4-3-5-7(8)9(10)12-2/h3-6H,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.157 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.532-1.534 |
| Water Solubility: | very slightly soluble in water; soluble in organic solvents, oils |
| Solubility: | very slightly soluble in water; soluble in organic solvents, oils |
| Appearance: | colourless or pale yellow liquid with a warm, herbaceous, floral, spicy odour |
| HS Code: | 29189090 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
