| Identification | |
| Name: | Acetic acid,2,2-diethoxy-, ethyl ester |
| Synonyms: | Aceticacid, diethoxy-, ethyl ester (9CI); Glyoxylic acid, ethyl ester, 2-(diethylacetal) (8CI); Glyoxylic acid, ethyl ester, diethyl acetal (6CI,7CI); Ethyl2,2-diethoxyacetate; Ethyl diethoxyacetate |
| CAS: | 6065-82-3 |
| EINECS: | 227-999-8 |
| Molecular Formula: | C8H16 O4 |
| Molecular Weight: | 176.21 |
| InChI: | InChI=1/C8H16O4/c1-4-10-7(9)8(11-5-2)12-6-3/h8H,4-6H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2810 |
| Melting Point: | 198-200oC |
| Density: | 0.988 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.41 |
| Solubility: | Insoluble |
| Appearance: | Colorless pure liquid |
| Specification: |
Ethyl diethoxyacetate , its CAS NO. is 6065-82-3, the synonyms are EINECS 227-999-8 ; Acetic acid, 2,2-diethoxy-, ethyl ester ; Acetic acid, diethoxy-, ethyl ester . |
| HS Code: | 29189090 |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Usage: | By-product in the synthesis of Ethyl-2-(diethoxyphosphoryl)-2-hydroxyacetate |
| Safety Data | |
 |
|
