| Identification | |
| Name: | Butanoic acid,2-ethyl-3-oxo-, ethyl ester |
| Synonyms: | Acetoaceticacid, 2-ethyl-, ethyl ester (6CI,7CI,8CI);2-Ethyl-3-oxobutanoic acid ethylester;2-Ethylacetoacetic acid ethyl ester;Ethyl 2-acetylbutanoate;Ethyl2-acetylbutyrate;Ethyl 2-ethyl-3-ketobutyrate;Ethyl 2-ethyl-3-oxobutanoate;Ethyl 2-ethyl-3-oxobutyrate;Ethyl 2-ethylacetoacetate;Ethyl2-ethylacetylacetate;Ethyl a-acetylbutyrate;Ethyl a-ethylacetoacetate;NSC 53775; |
| CAS: | 607-97-6 |
| EINECS: | 210-151-6 |
| Molecular Formula: | C8H14O3 |
| Molecular Weight: | 158.2 |
| InChI: | InChI=1/C8H14O3/c1-4-7(6(3)9)8(10)11-5-2/h7H,4-5H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.981 |
| Stability: | No data. |
| Refractive index: | 1.421 |
| Solubility: | Slightly soluble |
| Appearance: | Colorless liquid. |
| Specification: | Safety Statements:23-24/25-36-26 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 24/25:Avoid contact with skin and eyes 36:Wear suitable protective clothing 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
