| Identification | |
| Name: | 9-(1-Methyl-piperidyl-(2)-methyl)-carbazol |
| Synonyms: | 9-(1-Methyl-2-piperidylmethyl)-9H-carbazole;P-908 |
| CAS: | 60706-49-2 |
| Molecular Formula: | C19H22N2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C19H22N2/c1-20-13-7-6-8-15(20)14-21-18-11-4-2-9-16(18)17-10-3-5-12-19(17)21/h2-5,9-12,15H,6-8,13-14H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 218.1°C |
| Boiling Point: | 437°C at 760 mmHg |
| Density: | 1.13g/cm3 |
| Refractive index: | 1.633 |
| Specification: |
9-(1-Methyl-piperidyl-(2)-methyl)-carbazol , its cas register number is 60706-49-2. It also can be called BRN 0486914 ; and Carbazole, 9-(1-methyl-2-piperidyl)methyl- . |
| Flash Point: | 218.1°C |
| Safety Data | |
 |
|
