| Identification | |
| Name: | Benzonitrile,3-amino-4-methyl- |
| Synonyms: | p-Tolunitrile,3-amino- (6CI); 2-Methyl-5-cyanoaniline; 3-Amino-4-methylbenzonitrile;4-Cyano-2-aminotoluene; 5-Cyano-2-methylaniline |
| CAS: | 60710-80-7 |
| Molecular Formula: | C8H8 N2 |
| Molecular Weight: | 132.16 |
| InChI: | InChI=1/C8H8N2/c1-6-2-3-7(5-9)4-8(6)10/h2-4H,10H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3276 |
| Flash Point: | 142.987°C |
| Boiling Point: | 312.817°C at 760 mmHg |
| Density: | 1.105g/cm3 |
| Refractive index: | 1.576 |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 142.987°C |
| Safety Data | |
 |
|
