| Identification | |
| Name: | Benzene,1,3,5-trimethyl-2,4-dinitro- |
| Synonyms: | Mesitylene,2,4-dinitro- (6CI,7CI,8CI); 1,3,5-Trimethyl-2,4-dinitrobenzene;1,3-Dinitro-2,4,6-trimethylbenzene; 2,4-Dinitro-1,3,5-trimethylbenzene;2,4-Dinitromesitylene; Dinitromesitylene; NSC 6147 |
| CAS: | 608-50-4 |
| EINECS: | 210-164-7 |
| Molecular Formula: | C9H10 N2 O4 |
| Molecular Weight: | 210.21 |
| InChI: | InChI=1/C9H10N2O4/c1-5-4-6(2)9(11(14)15)7(3)8(5)10(12)13/h4H,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 150.6°C |
| Boiling Point: | 323.5°C at 760 mmHg |
| Density: | 1.297g/cm3 |
| Refractive index: | 1.579 |
| Specification: |
2,4-Dinitromesitylene ,its cas register number is 608-50-4. It also can be called Dinitromesitylene ; Mesitylene, 2,4-dinitro- ; and Benzene, 1,3,5-trimethyl-2,4-dinitro- . |
| Flash Point: | 150.6°C |
| Safety Data | |
 |
|
