| Identification | |
| Name: | Dulcitol |
| Synonyms: | Dulcite;Galactitol;Dulcose;Euonymit;Melampyrin;Melampyrit;NSC 1944; |
| CAS: | 608-66-2 |
| EINECS: | 210-165-2 |
| Molecular Formula: | C6H14O6 |
| Molecular Weight: | 182.17 |
| InChI: | InChI=1/C6H14O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3-12H,1-2H2/t3-,4+,5+,6- |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.28 g/mL at 25 °C |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | n20/D 1.46 |
| Water Solubility: | SOLUBLE IN HOT WATER |
| Solubility: | SOLUBLE IN HOT WATER |
| Appearance: | White crystals. |
| HS Code: | 29054990 |
| Storage Temperature: | Store at RT. |
| Color: | Orthorhombic needles from alc WHITE, CRYSTALLINE POWDER OR FREE FLOWING GRANULES |
| Usage: | In people with galactokinase deficiency, excess galactitol formation in the lens of the eye leads to cataracts. |
| Safety Data | |
 |
|
