| Identification | |
| Name: | Cyclohexane,1,2,3,4,5,6-hexachloro- |
| Synonyms: | 1,2,3,4,5,6-Hexachlorocyclohexane;BHC; HCH; NSC 11807; NSC 7909; NSC 8093 |
| CAS: | 608-73-1 |
| EINECS: | 210-168-9 |
| Molecular Formula: | C6H6 Cl6 |
| Molecular Weight: | 290.82 |
| InChI: | InChI=1/C6H6Cl6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-6H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2761 |
| Melting Point: | 141.5 deg C |
| Density: | 1.59g/cm3 |
| Refractive index: | 1.532 |
| Solubility: | 10 ppm in water; 24.4 g/100 g ethanol; 35.4 g/100 g ether; 41.1 g/100 g benzene In water, 31.4 mg/L at 25 eg C [Shiu WY et al; Rev Environ Contam Toxicol 116: 15-187 (1990)] PubMed Abstract |
| Specification: | Safety Statements:22-36/37-45-60-61 22:Do not breathe dust 36/37:Wear suitable protective clothing and gloves 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 60:This material and/or its container must be disposed of as hazardous waste 61:Avoid release to the environment. Refer to special instructions safety data sheet |
| Packinggroup: | III |
| Color: | Crystals or fine platelets |
| Safety Data | |
| Hazard Symbols |
Toxic by ingestion and inhalation, absorbed by skin, strong irritant to skin and eyes. CNS depressant. Use may be restricted. TLV: (lindane) 0.5
|
 |
|
