| Identification | |
| Name: | Benzenethiol,3-chloro-4-fluoro- |
| Synonyms: | 3-Chloro-4-fluorobenzenethiol;3-Chloro-4-fluorothiophenol |
| CAS: | 60811-23-6 |
| Molecular Formula: | C6H4 Cl F S |
| Molecular Weight: | 161.605 |
| InChI: | InChI=1/C6H4ClFS/c7-5-3-4(9)1-2-6(5)8/h1-3,9H/p-1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.375±0.06 g/cm3 (20 ºC 760 Torr) |
| Refractive index: | 1.5705-1.5735 |
| Appearance: | clear colorless to light yellow liquid |
| Specification: | clear colorless to light yellow liquid Safety Statements:36/37/39-26 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Sensitive: | Stench |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
