| Identification | |
| Name: | 1,4,7,10,13-Benzopentaoxacyclopentadecin-15-carboxaldehyde,2,3,5,6,8,9,11,12-octahydro- |
| Synonyms: | 15-Formyl-2,3,5,6,8,9,11,12-octahydro-1,4,7,10,13-benzopentaoxacyclopentadecine;15-Formylbenzo[15-crown-5]; 4-Formylbenzo-15-crown-5;4'-Formylbenzo-15-crown-5; 4'-Formylbenzo-15-crown-5 ether; NSC 288923 |
| CAS: | 60835-73-6 |
| Molecular Formula: | C15H20 O6 |
| Molecular Weight: | 296.32 |
| InChI: | InChI=1/C15H20O6/c16-12-13-1-2-14-15(11-13)21-10-8-19-6-4-17-3-5-18-7-9-20-14/h1-2,11-12H,3-10H2 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 78-81 °C(lit.) |
| Flash Point: | 203.8°C |
| Boiling Point: | 458.3°C at 760 mmHg |
| Density: | 1.127g/cm3 |
| Refractive index: | 1.492 |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 203.8°C |
| Safety Data | |
 |
|
