Identification |
Name: | 1,4,7,10,13-Benzopentaoxacyclopentadecin-15-carboxaldehyde,2,3,5,6,8,9,11,12-octahydro- |
Synonyms: | 15-Formyl-2,3,5,6,8,9,11,12-octahydro-1,4,7,10,13-benzopentaoxacyclopentadecine;15-Formylbenzo[15-crown-5]; 4-Formylbenzo-15-crown-5;4'-Formylbenzo-15-crown-5; 4'-Formylbenzo-15-crown-5 ether; NSC 288923 |
CAS: | 60835-73-6 |
Molecular Formula: | C15H20 O6 |
Molecular Weight: | 296.32 |
InChI: | InChI=1/C15H20O6/c16-12-13-1-2-14-15(11-13)21-10-8-19-6-4-17-3-5-18-7-9-20-14/h1-2,11-12H,3-10H2 |
Molecular Structure: |
![(C15H20O6) 15-Formyl-2,3,5,6,8,9,11,12-octahydro-1,4,7,10,13-benzopentaoxacyclopentadecine;15-Formylbenzo[15-cr...](https://img1.guidechem.com/chem/e/dict/45/60835-73-6.jpg) |
Properties |
Melting Point: | 78-81 °C(lit.)
|
Flash Point: | 203.8°C |
Boiling Point: | 458.3°C at 760 mmHg |
Density: | 1.127g/cm3 |
Refractive index: | 1.492 |
Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36:Wear suitable protective clothing |
Flash Point: | 203.8°C |
Safety Data |
|
![](/images/detail_15.png) |