| Identification | |
| Name: | 1-Propanone,2-chloro-1-phenyl- |
| Synonyms: | Propiophenone,2-chloro- (6CI,7CI,8CI); 2-Chloro-1-phenyl-1-propanone; 2-Chloropropiophenone;NSC 5663; a-Chloropropiophenone |
| CAS: | 6084-17-9 |
| EINECS: | 230-330-2 |
| Molecular Formula: | C9H9 Cl O |
| Molecular Weight: | 168.62 |
| InChI: | InChI=1/C9H9ClO/c1-7(10)9(11)8-5-3-2-4-6-8/h2-7H,1H3/t7-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 118.4°C |
| Boiling Point: | 241.8°C at 760 mmHg |
| Density: | 1.129g/cm3 |
| Refractive index: | 1.524 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 118.4°C |
| Safety Data | |
 |
|
