| Identification | |
| Name: | 1H-Indene-4-carbonitrile,2,3-dihydro-1-oxo- |
| Synonyms: | 4-Cyano-1-indanone;4-Cyanoindanone; |
| CAS: | 60899-34-5 |
| Molecular Formula: | C10H7NO |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C10H7NO/c11-6-7-2-1-3-9-8(7)4-5-10(9)12/h1-3H,4-5H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.23 g/cm3 |
| Refractive index: | 1.596 |
| Specification: |
The 4-Cyano-1-indanone ,its cas register number is 60899-34-5.It also can be called as 2,3-Dihydro-1-oxo-1H-indene-4-carbonitrile and the IUPAC name about this chemicals is 1-Oxo-2,3-dihydroindene-4-carbonitrile .It belongs to the Building Blocks. Following are the chemical properties about 4-Cyano-1-indanone :(1)#H bond acceptors: 2 ; (2)#H bond donors: 0 ; (3)#Freely Rotating Bonds: 0 ; (4)Polar Surface Area: 40.86 Å ; (5)Index of Refraction: 1.596 ; (6)Molar Refractivity: 43.27 cm3 ; (7)Molar Volume: 127.1 cm3; (8)Surface Tension: 54.4 dyne/cm; (9)Enthalpy of Vaporization: 57.26 kJ/mol ; (10)Vapour Pressure: 0.00017 mmHg at 25°C . This chemicals can be described computed from structure: |
| Safety Data | |
 |
|
