| Identification | |
| Name: | Propanedioicacid, 2-methyl-, 1,3-diethyl ester |
| Synonyms: | Malonicacid, methyl-, diethyl ester (6CI,7CI,8CI);Propanedioic acid, methyl-, diethylester (9CI);2-Methylmalonic acid diethyl ester;Diethyl 2-methylmalonate;Diethyl a-methylmalonate;Methylmalonic acid diethyl ester;NSC 8700; |
| CAS: | 609-08-5 |
| EINECS: | 210-175-7 |
| Molecular Formula: | C8H14O4 |
| Molecular Weight: | 174.2 |
| InChI: | InChI=1/C8H14O4/c1-4-11-7(9)6(3)8(10)12-5-2/h6H,4-5H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.013 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.412-1.414 |
| Water Solubility: | immiscible |
| Solubility: | Immiscible with water |
| Appearance: | Clear liquid |
| HS Code: | 29171990 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Diethyl methylmalonate is used as intermediate for the syntheses of pharmaceuticals, e.g. non-steroidal anti-inflammatory agents with 2-acrylpropionic acid structures acrylpropionic acid structure. It is also used in the flavour and fragrance industries. Product Data Sheet |
| Safety Data | |
 |
|
