| Identification |
| Name: | Butanoic acid,2-methyl-3-oxo-, ethyl ester |
| Synonyms: | Acetoaceticacid, 2-methyl-, ethyl ester (6CI,7CI,8CI);Acetoacetic acid, a-methyl-, ethyl ester (3CI);2-Methyl-3-oxobutanoic acid ethyl ester;2-Methyl-3-oxobutyric acid ethylester;2-Methylacetoacetic acid ethyl ester;Ethyl 2-acetylpropanoate;Ethyl 2-acetylpropionate;Ethyl 2-methyl-3-oxobutanoate;Ethyl2-methyl-3-oxobutyrate;Ethyl3-oxo-2-methylbutanoate;Ethyl methylacetoacetate;Ethyl a-acetylpropionate;Ethyl a-methylacetoacetate;Ethyl a-methylacetylacetate;NSC 1102;a-Methylacetoacetic ester; |
| CAS: | 609-14-3 |
| EINECS: | 210-179-9 |
| Molecular Formula: | C7H12O3 |
| Molecular Weight: | 144.17 |
| InChI: | InChI=1/C7H12O3/c1-4-10-7(9)5(2)6(3)8/h5H,4H2,1-3H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 1993 |
| Density: | 1.019 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.417-1.419 |
| Water Solubility: | IMMISCIBLE |
| Solubility: | IMMISCIBLE |
| Appearance: | clear colorless to yellow liquid |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| |
 |
