| Identification | |
| Name: | 1,4-Benzenediamine,2,6-dichloro- |
| Synonyms: | p-Phenylenediamine,2,6-dichloro- (6CI,7CI,8CI); 2,6-Dichloro-1,4-benzenediamine;2,6-Dichloro-1,4-phenylenediamine; 2,6-Dichloro-p-phenylenediamine;3,5-Dichloro-1,4-phenylenediamine; 4-Amino-2,6-dichloroaniline; C.I. 37020;Daito Brown Salt RR; NSC 60685 |
| CAS: | 609-20-1 |
| EINECS: | 210-184-6 |
| Molecular Formula: | C6H6 Cl2 N2 |
| Molecular Weight: | 177.04 |
| InChI: | InChI=1/C6H6Cl2N2/c7-4-1-3(9)2-5(8)6(4)10/h1-2H,9-10H2 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 122-127 °C |
| Flash Point: | 139.3°C |
| Boiling Point: | 306.6°C at 760 mmHg |
| Density: | 1.501g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.679 |
| Specification: | grey powder Safety Statements:26 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Flash Point: | 139.3°C |
| Safety Data | |
 |
|
