| Identification | |
| Name: | Furan, 2-nitro- |
| Synonyms: | 2-Nitrofuran;5-Nitrofuran; NSC 59983; Nitrofuran |
| CAS: | 609-39-2 |
| Molecular Formula: | C4H3 N O3 |
| Molecular Weight: | 113.07152 |
| InChI: | InChI=1S/C4H3NO3/c6-5(7)4-2-1-3-8-4/h1-3H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1325 4.1/PG 2 |
| Melting Point: | 29-33 °C(lit.) |
| Flash Point: | 88 C (closed cup) |
| Boiling Point: | 84 °C13 mm Hg(lit.) |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Water Solubility: | Stability Stable. Incompatible with strong oxidizing agents. Toxicology Harmful if swallowed, inhaled or absorbed through the skin. May act as a carcinogen. Toxicity data |
| Solubility: |
|
| Appearance: | solid |
| Specification: | solid usageEng:A minor antimicrobial used in veterinary medicine. Safety Statements:7-23-36/37/39-45 7:Keep container tightly closed 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Flash Point: | 88 C (closed cup) |
| Usage: | A minor antimicrobial used in veterinary medicine. |
| Safety Data | |
 |
|
