| Identification | |
| Name: | 2-Nitrothiophene |
| Synonyms: | Thiophene, 2-nitro-;2-Nitrothiophene 85%;2-Nitro thiophene; |
| CAS: | 609-40-5 |
| EINECS: | 210-190-9 |
| Molecular Formula: | C4H3NO2S |
| Molecular Weight: | 129.13712 |
| InChI: | InChI=1S/C4H3NO2S/c6-5(7)4-2-1-3-8-4/h1-3H |
| Molecular Structure: |  |
| Properties | |
| Transport: | OTH |
| Density: | 1.36 |
| Stability: | Stable under normal temperatures and pressures. May discolor on exposure to light. |
| Refractive index: | 1.5855 (43 C) |
| Water Solubility: | SOLVENT |
| Solubility: | SOLVENT Appearance:yellowish solid Transport Information: OTH Hazard Symbols:UN NO. |
| Appearance: | yellowish solid |
| Specification: | white to light yellow crystal powder Safety Statements:24/25-36-26 24/25:Avoid contact with skin and eyes 36:Wear suitable protective clothing 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Report: |
Reported in EPA TSCA Inventory. |
| Storage Temperature: | Keep Cold |
| Sensitive: | Light Sensitive |
| Safety Data | |
| Hazard Symbols | |
 |
|
