| Identification | |
| Name: | 2-Chlorobenzoyl chloride |
| Synonyms: | OCOC; o-chlorophenyl chloride; o-p-chlorobenzoyl chloride; o-Chlorophenylacetyl chloride |
| CAS: | 609-65-4 |
| EINECS: | 210-194-0 |
| Molecular Formula: | C7H4Cl2O |
| Molecular Weight: | 175.01206 |
| InChI: | InChI=1S/C7H4Cl2O/c8-6-4-2-1-3-5(6)7(9)10/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3265 8 |
| Density: | 1.382 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5708-1.5728 |
| Water Solubility: | soluble in alcohol, acetone and ether |
| Solubility: | soluble in alcohol, acetone and ether |
| Appearance: | clear, colorless liquid |
| Specification: |
? 2-Chlorobenzoyl chloride , its CAS NO. is 609-65-4, the synonyms are 2-chloro-benzoylchlorid ; Benzoylchloride,2-chloro- ; chlorobenzoylchloride ; Benzoyl chloride, o-chloro- ; o-Chlorobenzonyl chloride . |
| Packinggroup: | II |
| HS Code: | 29163900 |
| Storage Temperature: | Keep container closed when not in use. Corrosives area. Store protected from moisture. |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
