| Identification | |
| Name: | Benzamide, 2-chloro- |
| Synonyms: | Benzamide,o-chloro- (6CI,7CI,8CI); 2-Chlorobenzamide; NSC 406895; o-Chlorobenzamide |
| CAS: | 609-66-5 |
| EINECS: | 210-195-6 |
| Molecular Formula: | C7H6 Cl N O |
| Molecular Weight: | 155.58 |
| InChI: | InChI=1/C7H6ClNO/c8-6-4-2-1-3-5(6)7(9)10/h1-4H,(H2,9,10) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 120.1 ºC |
| Boiling Point: | 275ºC |
| Density: | 1.295 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.582 |
| Appearance: | Almost white powder and chunks. |
| Specification: | ALMOST WHITE CRYSTALLINE POWDER Safety Statements:36-37/39-26 36:Wear suitable protective clothing 37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Flash Point: | 120.1 ºC |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
