| Identification | |
| Name: | 2,6-Dinitro-p-cresol;2,6-Dinitro-4-methylphenol |
| Synonyms: | p-Cresol,2,6-dinitro- (8CI); 2,6-Dinitro-4-cresol; 2,6-Dinitro-4-methylphenol;2,6-Dinitro-p-cresol; 3,5-Dinitro-4-hydroxytoluene; 4-Methyl-2,6-dinitrophenol;NSC 33870 |
| CAS: | 609-93-8 |
| EINECS: | 210-203-8 |
| Molecular Formula: | C7H6N2O5 |
| Molecular Weight: | 198.13 |
| InChI: | InChI=1/C7H6N2O5/c1-4-2-5(8(11)12)7(10)6(3-4)9(13)14/h2-3,10H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 |
| Density: | 1.55 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. Appear to be stable in acid solution, but are susceptible to decomposition by UV radiation in alkaline solution. |
| Refractive index: | 1.639 |
| Solubility: | insoluble |
| Appearance: | Yellow-orange flakes. |
| Packinggroup: | II |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Color: | YELLOW NEEDLES FROM ETHER OR PETROLEUM ETHER Light yellow crystalline solid |
| Usage: | Parent compd for intermediates, dyes and pharmaceuticals. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
