Identification |
Name: | myo-Inositol,1,2-anhydro- |
Synonyms: | DL-myo-Inositol,1,2-anhydro-;Inositol, 1,2-anhydro-, myo- (8CI);7-Oxabicyclo[4.1.0]heptane,DL-myo-inositol deriv.;Conduritol B epoxide; |
CAS: | 6090-95-5 |
Molecular Formula: | C6H10O5 |
Molecular Weight: |
162.14 |
InChI: | InChI=1/C6H10O5/c7-1-2(8)4(10)6-5(11-6)3(1)9/h1-10H/t1-,2-,3+,4+,5?,6?/m1/s1 |
Molecular Structure: |
![(C6H10O5) DL-myo-Inositol,1,2-anhydro-;Inositol, 1,2-anhydro-, myo- (8CI);7-Oxabicyclo[4.1.0]heptane,DL-myo-in...](https://img1.guidechem.com/chem/e/dict/154/6090-95-5.jpg) |
Properties |
Melting Point: | 157-159 |
Flash Point: | 171.811°C |
Boiling Point: | 360.478°C at 760 mmHg |
Density: | 1.926g/cm3 |
Stability: | Moisture Sensitive |
Refractive index: | 1.732 |
Appearance: | white crystalline solid |
Specification: | White Crystalline Solid usageEng:Conduritol B Epoxide acts on b-glucosidases from widely differing sources to show a loss of enzymic activity: from various Aspergillus species, yeast, snail, sweet almonds, and mammals. The other enzymes that have been found to be covalently inhibited are a- glucosidase from yeast and the sucrase-isomaltase complex from rabbit small intestine. |
Flash Point: | 171.811°C |
Storage Temperature: | 2-8°C |
Usage: | Conduritol B Epoxide acts on b-glucosidases from widely differing sources to show a loss of enzymic activity: from various Aspergillus species, yeast, snail, sweet almonds, and mammals. The other enzymes that have been found to be covalently inhibi |
Safety Data |
|
 |