| Identification |
| Name: | Carbamic acid,N-(2-chloroacetyl)-, ethyl ester |
| Synonyms: | Carbamicacid, (chloroacetyl)-, ethyl ester (6CI,7CI,8CI,9CI); (Chloroacetyl)carbamicacid ethyl ester; Ethyl (2-chloroacetyl)carbamate; Ethyl(chloroacetyl)carbamate; Ethyl N-(chloroacetyl)carbamate; NSC 32859 |
| CAS: | 6092-47-3 |
| Molecular Formula: | C5H8 Cl N O3 |
| Molecular Weight: | 165.57 |
| InChI: | InChI=1/C5H8ClNO3/c1-2-10-5(9)7-4(8)3-6/h2-3H2,1H3,(H,7,8,9) |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 126-131 °C
|
| Density: | 1.255g/cm3 |
| Refractive index: | 1.45 |
| Solubility: | Soluble in ethanol and acetone |
| Appearance: | White or gray crystalline powder with corrosion smell |
| Safety Data |
| |
 |
