| Identification | |
| Name: | 10H-Phenothiazine-10-propanamine,2-methoxy-N,N-dimethyl- |
| Synonyms: | Phenothiazine,10-[3-(dimethylamino)propyl]-2-methoxy- (8CI);10-(3-Dimethylaminopropyl)-2-methoxyphenothiazine;2-Methoxy-10-(3'-dimethylaminopropyl)phenothiazine; 2-Methoxypromazine; 4632RP;Methopromazine; Methoxypromazine; RP 4632 |
| CAS: | 61-01-8 |
| EINECS: | 200-497-6 |
| Molecular Formula: | C18H22 N2 O S |
| Molecular Weight: | 314.48 |
| InChI: | InChI=1/C18H22N2OS/c1-19(2)11-6-12-20-15-7-4-5-8-17(15)22-18-10-9-14(21-3)13-16(18)20/h4-5,7-10,13H,6,11-12H2,1-3H3 |
| Molecular Structure: | ![(C18H22N2OS) Phenothiazine,10-[3-(dimethylamino)propyl]-2-methoxy- (8CI);10-(3-Dimethylaminopropyl)-2-methoxyphen...](https://img1.guidechem.com/chem/e/dict/26/61-01-8.jpg) |
| Properties | |
| Flash Point: | 233.1°C |
| Boiling Point: | 461.8°C at 760 mmHg |
| Density: | 1.143g/cm3 |
| Refractive index: | 1.603 |
| Specification: |
2-Methoxypromazine ,its cas register number is 61-01-8. It also can be called Methopromazine ; 2-Methoxy-N,N-dimethyl-10H-phenothiazine-10-propanamine ; and 10H-phenothiazine-10-propanamine, 2-methoxy-N,N-dimethyl- . |
| Flash Point: | 233.1°C |
| Safety Data | |
 |
|
