| Identification | |
| Name: | 2-Nitrobenzamide |
| Synonyms: | - |
| CAS: | 610-15-1 |
| EINECS: | 210-208-5 |
| Molecular Formula: | C7H6N2O3 |
| Molecular Weight: | 166.13 |
| InChI: | InChI=1/C7H6N2O3/c8-7(10)5-3-1-2-4-6(5)9(11)12/h1-4H,(H2,8,10) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.385g/cm3 |
| Refractive index: | 1.612 |
| Specification: |
2-Nitrobenzamide (610-15-1) is beige crystalline powder, known as 2-Carbamoylnitrobenzene ; 4-09-00-01049 (Beilstein Handbook Reference) ; NSC 407995 ; o-Nitrobenzamide ; 2-Nitrobenzamide ; Benzamide, 2-nitro- ; Benzamide, 2-nitro- (9CI) ; Benzamide, o-nitro- . It is incompatible with strong oxidizing agents, strong bases. When heated to decomposition, it yields Nitrogen oxides, Carbon monoxide , irritating and toxic fumes and gases, Carbon dioxide , Nitrogen . |
| Safety Data | |
 |
|
